C15H17F2NO5 — CID 135238889
(Z)-3-[4-(difluoromethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid (PubChem CID 135238889) has the molecular formula C15H17F2NO5 and a molecular weight of 329.30 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 135238889 |
| Molecular Formula | C15H17F2NO5 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=C\c1ccc(OC(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C15H17F2NO5/c1-15(2,3)23-14(21)18-11(12(19)20)8-9-4-6-10(7-5-9)22-13(16)17/h4-8,13H,1-3H3,(H,18,21)(H,19,20)/b11-8- |
| InChIKey | XIBDSQMXRYFJJU-FLIBITNWSA-N |
| XLogP | 3.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|