C27H26F2N2O3 — CID 5001676
2-[[4-(difluoromethoxy)phenyl]methylidene]-N,N'-bis(1-phenylethyl)propanediamide (PubChem CID 5001676) has the molecular formula C27H26F2N2O3 and a molecular weight of 464.51 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methylidene]-N,N'-bis(1-phenylethyl)propanediamide.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methylidene]-N,N'-bis(1-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 5001676 |
| Molecular Formula | C27H26F2N2O3 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methylidene]-N,N'-bis(1-phenylethyl)propanediamide |
| SMILES | CC(NC(=O)C(=Cc1ccc(OC(F)F)cc1)C(=O)NC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26F2N2O3/c1-18(21-9-5-3-6-10-21)30-25(32)24(17-20-13-15-23(16-14-20)34-27(28)29)26(33)31-19(2)22-11-7-4-8-12-22/h3-19,27H,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | DXRWLEFBLNWRBY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|