C27H27BrN2O4 — CID 2350563
2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N-[(1S)-1-phenylethyl]-N'-[(1R)-1-phenylethyl]propanediamide (PubChem CID 2350563) has the molecular formula C27H27BrN2O4 and a molecular weight of 523.43 g/mol. Its IUPAC name is 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N-[(1S)-1-phenylethyl]-N'-[(1R)-1-phenylethyl]propanediamide.
| Compound Name | 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N-[(1S)-1-phenylethyl]-N'-[(1R)-1-phenylethyl]propanediamide |
|---|---|
| PubChem CID | 2350563 |
| Molecular Formula | C27H27BrN2O4 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-N-[(1S)-1-phenylethyl]-N'-[(1R)-1-phenylethyl]propanediamide |
| SMILES | COc1cc(/C=C(/C(=O)N[C@@H](C)c2ccccc2)C(=O)N[C@H](C)c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C27H27BrN2O4/c1-17(20-10-6-4-7-11-20)29-26(32)22(14-19-15-23(28)25(31)24(16-19)34-3)27(33)30-18(2)21-12-8-5-9-13-21/h4-18,31H,1-3H3,(H,29,32)(H,30,33)/b22-14-/t17-,18+/m0/s1 |
| InChIKey | GQQZSQWACJKXNA-YBAMZQCISA-N |
| XLogP | 5.30 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|