C19H17F2N3O2 — CID 19514167
3-[4-(difluoromethoxy)phenyl]-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide (PubChem CID 19514167) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19514167 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccc(OC(F)F)cc2)n[nH]1)c1ccccc1 |
| InChI | InChI=1S/C19H17F2N3O2/c1-12(13-5-3-2-4-6-13)22-18(25)17-11-16(23-24-17)14-7-9-15(10-8-14)26-19(20)21/h2-12,19H,1H3,(H,22,25)(H,23,24) |
| InChIKey | SQTGMYSLCUYKHN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |