C22H25N3O2 — CID 71822328
3-(2-butoxyphenyl)-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide (PubChem CID 71822328) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-(2-butoxyphenyl)-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2-butoxyphenyl)-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71822328 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-(2-butoxyphenyl)-N-(1-phenylethyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCCOc1ccccc1-c1cc(C(=O)NC(C)c2ccccc2)[nH]n1 |
| InChI | InChI=1S/C22H25N3O2/c1-3-4-14-27-21-13-9-8-12-18(21)19-15-20(25-24-19)22(26)23-16(2)17-10-6-5-7-11-17/h5-13,15-16H,3-4,14H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | QNFLWHYIFQGQEX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|