C22H23N3O4 — CID 71822343
N-(1,3-benzodioxol-5-ylmethyl)-3-(2-butoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 71822343) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(2-butoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(2-butoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71822343 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(2-butoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCCOc1ccccc1-c1cc(C(=O)NCc2ccc3c(c2)OCO3)[nH]n1 |
| InChI | InChI=1S/C22H23N3O4/c1-2-3-10-27-19-7-5-4-6-16(19)17-12-18(25-24-17)22(26)23-13-15-8-9-20-21(11-15)29-14-28-20/h4-9,11-12H,2-3,10,13-14H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | ASAUQYIQHMHJIS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|