C23H25N3O2 — CID 71822324
3-(2-butoxyphenyl)-N-(2,3-dihydro-1H-inden-1-yl)-1H-pyrazole-5-carboxamide (PubChem CID 71822324) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-(2-butoxyphenyl)-N-(2,3-dihydro-1H-inden-1-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2-butoxyphenyl)-N-(2,3-dihydro-1H-inden-1-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71822324 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 3-(2-butoxyphenyl)-N-(2,3-dihydro-1H-inden-1-yl)-1H-pyrazole-5-carboxamide |
| SMILES | CCCCOc1ccccc1-c1cc(C(=O)NC2CCc3ccccc32)[nH]n1 |
| InChI | InChI=1S/C23H25N3O2/c1-2-3-14-28-22-11-7-6-10-18(22)20-15-21(26-25-20)23(27)24-19-13-12-16-8-4-5-9-17(16)19/h4-11,15,19H,2-3,12-14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | FNALCNOTSBORCF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|