C20H24N2O2 — CID 5221280
1-(4-butoxyphenyl)-3-(2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 5221280) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-(2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(4-butoxyphenyl)-3-(2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 5221280 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-(2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | CCCCOc1ccc(NC(=O)NC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-3-14-24-17-11-9-16(10-12-17)21-20(23)22-19-13-8-15-6-4-5-7-18(15)19/h4-7,9-12,19H,2-3,8,13-14H2,1H3,(H2,21,22,23) |
| InChIKey | VIYCXBTWOFPHLQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|