C17H8F7N3O2 — CID 19514191
3-[4-(difluoromethoxy)phenyl]-N-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19514191) has the molecular formula C17H8F7N3O2 and a molecular weight of 419.26 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19514191 |
| Molecular Formula | C17H8F7N3O2 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-(2,3,4,5,6-pentafluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)c1cc(-c2ccc(OC(F)F)cc2)n[nH]1 |
| InChI | InChI=1S/C17H8F7N3O2/c18-10-11(19)13(21)15(14(22)12(10)20)25-16(28)9-5-8(26-27-9)6-1-3-7(4-2-6)29-17(23)24/h1-5,17H,(H,25,28)(H,26,27) |
| InChIKey | KDXPKAFLYQUZOC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|