C30H35N3O2 — CID 2375722
2-[[4-(diethylamino)phenyl]methylidene]-N,N'-bis[(1R)-1-phenylethyl]propanediamide (PubChem CID 2375722) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-[[4-(diethylamino)phenyl]methylidene]-N,N'-bis[(1R)-1-phenylethyl]propanediamide.
| Compound Name | 2-[[4-(diethylamino)phenyl]methylidene]-N,N'-bis[(1R)-1-phenylethyl]propanediamide |
|---|---|
| PubChem CID | 2375722 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-[[4-(diethylamino)phenyl]methylidene]-N,N'-bis[(1R)-1-phenylethyl]propanediamide |
| SMILES | CCN(CC)c1ccc(C=C(C(=O)N[C@H](C)c2ccccc2)C(=O)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N3O2/c1-5-33(6-2)27-19-17-24(18-20-27)21-28(29(34)31-22(3)25-13-9-7-10-14-25)30(35)32-23(4)26-15-11-8-12-16-26/h7-23H,5-6H2,1-4H3,(H,31,34)(H,32,35)/t22-,23-/m1/s1 |
| InChIKey | ROJKSRUQLRLWAN-DHIUTWEWSA-N |
| XLogP | 5.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|