C13H17NO2S — CID 5381011
(E)-3-[4-(diethylamino)phenyl]-2-sulfanylprop-2-enoic acid (PubChem CID 5381011) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (E)-3-[4-(diethylamino)phenyl]-2-sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-[4-(diethylamino)phenyl]-2-sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 5381011 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (E)-3-[4-(diethylamino)phenyl]-2-sulfanylprop-2-enoic acid |
| SMILES | CCN(CC)c1ccc(/C=C(/S)C(=O)O)cc1 |
| InChI | InChI=1S/C13H17NO2S/c1-3-14(4-2)11-7-5-10(6-8-11)9-12(17)13(15)16/h5-9,17H,3-4H2,1-2H3,(H,15,16)/b12-9+ |
| InChIKey | CYAKSFSMPBPKFB-FMIVXFBMSA-N |
| XLogP | 2.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|