C20H22ClNO2 — CID 83951117
(Z)-2-(3-chloro-4-methylphenyl)-3-[4-(diethylamino)phenyl]prop-2-enoic acid (PubChem CID 83951117) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is (Z)-2-(3-chloro-4-methylphenyl)-3-[4-(diethylamino)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-(3-chloro-4-methylphenyl)-3-[4-(diethylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 83951117 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (Z)-2-(3-chloro-4-methylphenyl)-3-[4-(diethylamino)phenyl]prop-2-enoic acid |
| SMILES | CCN(CC)c1ccc(/C=C(\C(=O)O)c2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H22ClNO2/c1-4-22(5-2)17-10-7-15(8-11-17)12-18(20(23)24)16-9-6-14(3)19(21)13-16/h6-13H,4-5H2,1-3H3,(H,23,24)/b18-12- |
| InChIKey | NJMLSYCBSFXBQI-PDGQHHTCSA-N |
| XLogP | 5.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|