C16H11Cl2FO2 — CID 83952947
(Z)-3-(2-chloro-6-fluorophenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid (PubChem CID 83952947) has the molecular formula C16H11Cl2FO2 and a molecular weight of 325.17 g/mol. Its IUPAC name is (Z)-3-(2-chloro-6-fluorophenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(2-chloro-6-fluorophenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83952947 |
| Molecular Formula | C16H11Cl2FO2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (Z)-3-(2-chloro-6-fluorophenyl)-2-(3-chloro-4-methylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(/C(=C/c2c(F)cccc2Cl)C(=O)O)cc1Cl |
| InChI | InChI=1S/C16H11Cl2FO2/c1-9-5-6-10(7-14(9)18)11(16(20)21)8-12-13(17)3-2-4-15(12)19/h2-8H,1H3,(H,20,21)/b11-8- |
| InChIKey | UWRSOUCJOMVEIZ-FLIBITNWSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|