C17H14Cl2O2 — CID 83955455
(Z)-3-(2,6-dichlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid (PubChem CID 83955455) has the molecular formula C17H14Cl2O2 and a molecular weight of 321.20 g/mol. Its IUPAC name is (Z)-3-(2,6-dichlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(2,6-dichlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83955455 |
| Molecular Formula | C17H14Cl2O2 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | (Z)-3-(2,6-dichlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(/C(=C/c2c(Cl)cccc2Cl)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H14Cl2O2/c1-10-6-7-12(11(2)8-10)13(17(20)21)9-14-15(18)4-3-5-16(14)19/h3-9H,1-2H3,(H,20,21)/b13-9- |
| InChIKey | VNYOSOYQVVTGTG-LCYFTJDESA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|