C17H15ClO2 — CID 83954536
(Z)-3-(4-chlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid (PubChem CID 83954536) has the molecular formula C17H15ClO2 and a molecular weight of 286.76 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4-chlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83954536 |
| Molecular Formula | C17H15ClO2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-2-(2,4-dimethylphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(/C(=C/c2ccc(Cl)cc2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H15ClO2/c1-11-3-8-15(12(2)9-11)16(17(19)20)10-13-4-6-14(18)7-5-13/h3-10H,1-2H3,(H,19,20)/b16-10- |
| InChIKey | VYTHABAZLGJKDZ-YBEGLDIGSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|