C18H18O3 — CID 83955074
(Z)-2-(2-methoxy-5-methylphenyl)-3-(4-methylphenyl)prop-2-enoic acid (PubChem CID 83955074) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (Z)-2-(2-methoxy-5-methylphenyl)-3-(4-methylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(2-methoxy-5-methylphenyl)-3-(4-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83955074 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (Z)-2-(2-methoxy-5-methylphenyl)-3-(4-methylphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(C)cc1/C(=C/c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C18H18O3/c1-12-4-7-14(8-5-12)11-16(18(19)20)15-10-13(2)6-9-17(15)21-3/h4-11H,1-3H3,(H,19,20)/b16-11- |
| InChIKey | WZDUNNHBWTXXHO-WJDWOHSUSA-N |
| XLogP | 3.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|