C20H22O3 — CID 83951821
(Z)-2-(2,5-dimethylphenyl)-3-(4-propan-2-yloxyphenyl)prop-2-enoic acid (PubChem CID 83951821) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (Z)-2-(2,5-dimethylphenyl)-3-(4-propan-2-yloxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(2,5-dimethylphenyl)-3-(4-propan-2-yloxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83951821 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (Z)-2-(2,5-dimethylphenyl)-3-(4-propan-2-yloxyphenyl)prop-2-enoic acid |
| SMILES | Cc1ccc(C)c(/C(=C/c2ccc(OC(C)C)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C20H22O3/c1-13(2)23-17-9-7-16(8-10-17)12-19(20(21)22)18-11-14(3)5-6-15(18)4/h5-13H,1-4H3,(H,21,22)/b19-12- |
| InChIKey | USDMRJACKIEIGR-UNOMPAQXSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|