C20H21ClO3 — CID 112720533
(Z)-3-(3-chloro-4-propoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid (PubChem CID 112720533) has the molecular formula C20H21ClO3 and a molecular weight of 344.84 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4-propoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3-chloro-4-propoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 112720533 |
| Molecular Formula | C20H21ClO3 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (Z)-3-(3-chloro-4-propoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid |
| SMILES | CCCOc1ccc(/C=C(\C(=O)O)c2cc(C)ccc2C)cc1Cl |
| InChI | InChI=1S/C20H21ClO3/c1-4-9-24-19-8-7-15(12-18(19)21)11-17(20(22)23)16-10-13(2)5-6-14(16)3/h5-8,10-12H,4,9H2,1-3H3,(H,22,23)/b17-11- |
| InChIKey | AGGAZVSETFRSHO-BOPFTXTBSA-N |
| XLogP | 5.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|