C21H24O3 — CID 83951937
(Z)-3-(4-butoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid (PubChem CID 83951937) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (Z)-3-(4-butoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4-butoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83951937 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (Z)-3-(4-butoxyphenyl)-2-(2,5-dimethylphenyl)prop-2-enoic acid |
| SMILES | CCCCOc1ccc(/C=C(\C(=O)O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C21H24O3/c1-4-5-12-24-18-10-8-17(9-11-18)14-20(21(22)23)19-13-15(2)6-7-16(19)3/h6-11,13-14H,4-5,12H2,1-3H3,(H,22,23)/b20-14- |
| InChIKey | QIUUTGUQUWMXSF-ZHZULCJRSA-N |
| XLogP | 5.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|