C21H25NO3 — CID 54230127
2-(4-aminophenyl)-3-(4-hexoxyphenyl)prop-2-enoic acid (PubChem CID 54230127) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3-(4-hexoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-(4-aminophenyl)-3-(4-hexoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54230127 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-(4-aminophenyl)-3-(4-hexoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(C=C(C(=O)O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-2-3-4-5-14-25-19-12-6-16(7-13-19)15-20(21(23)24)17-8-10-18(22)11-9-17/h6-13,15H,2-5,14,22H2,1H3,(H,23,24) |
| InChIKey | QIQUPQAHSIUNHC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|