C22H24O3 — CID 83951899
(Z)-3-(4-propoxyphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enoic acid (PubChem CID 83951899) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is (Z)-3-(4-propoxyphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4-propoxyphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83951899 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (Z)-3-(4-propoxyphenyl)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enoic acid |
| SMILES | CCCOc1ccc(/C=C(\C(=O)O)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C22H24O3/c1-2-13-25-20-11-7-16(8-12-20)14-21(22(23)24)19-10-9-17-5-3-4-6-18(17)15-19/h7-12,14-15H,2-6,13H2,1H3,(H,23,24)/b21-14- |
| InChIKey | GMEHLCJBWKWAIY-STZFKDTASA-N |
| XLogP | 4.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|