C17H16O2S — CID 83951585
(Z)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylprop-2-enoic acid (PubChem CID 83951585) has the molecular formula C17H16O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is (Z)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (Z)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 83951585 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (Z)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cccs1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C17H16O2S/c18-17(19)16(11-15-6-3-9-20-15)14-8-7-12-4-1-2-5-13(12)10-14/h3,6-11H,1-2,4-5H2,(H,18,19)/b16-11- |
| InChIKey | YWXNHFVSIDHWRO-WJDWOHSUSA-N |
| XLogP | 4.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|