C12H12O2 — CID 57251163
2-(2,3-dihydro-1H-inden-5-yl)prop-2-enoic acid (PubChem CID 57251163) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)prop-2-enoic acid.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 57251163 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H12O2/c1-8(12(13)14)10-6-5-9-3-2-4-11(9)7-10/h5-7H,1-4H2,(H,13,14) |
| InChIKey | HLEBPARSLSSEAK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|