C16H12Br2O — CID 107979596
(3,5-dibromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanone (PubChem CID 107979596) has the molecular formula C16H12Br2O and a molecular weight of 380.08 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanone.
| Compound Name | (3,5-dibromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanone |
|---|---|
| PubChem CID | 107979596 |
| Molecular Formula | C16H12Br2O |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | (3,5-dibromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanone |
| SMILES | O=C(c1cc(Br)cc(Br)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H12Br2O/c17-14-7-13(8-15(18)9-14)16(19)12-5-4-10-2-1-3-11(10)6-12/h4-9H,1-3H2 |
| InChIKey | XPBQOQCTOKMKSP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |