C20H16O — CID 43338934
2,3-dihydro-1H-inden-5-yl(naphthalen-2-yl)methanone (PubChem CID 43338934) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl(naphthalen-2-yl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-5-yl(naphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 43338934 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl(naphthalen-2-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCC2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16O/c21-20(19-11-9-15-6-3-7-17(15)13-19)18-10-8-14-4-1-2-5-16(14)12-18/h1-2,4-5,8-13H,3,6-7H2 |
| InChIKey | CAYIALAPVJRAAY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |