C19H15NO — CID 103134049
2,3-dihydro-1H-inden-5-yl(isoquinolin-8-yl)methanone (PubChem CID 103134049) has the molecular formula C19H15NO and a molecular weight of 273.33 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl(isoquinolin-8-yl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-5-yl(isoquinolin-8-yl)methanone |
|---|---|
| PubChem CID | 103134049 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl(isoquinolin-8-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCC2)c1cccc2ccncc12 |
| InChI | InChI=1S/C19H15NO/c21-19(16-8-7-13-3-1-5-15(13)11-16)17-6-2-4-14-9-10-20-12-18(14)17/h2,4,6-12H,1,3,5H2 |
| InChIKey | AZQPYCAJPDWXPH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |