C16H13FO — CID 43338936
2,3-dihydro-1H-inden-5-yl-(2-fluorophenyl)methanone (PubChem CID 43338936) has the molecular formula C16H13FO and a molecular weight of 240.28 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(2-fluorophenyl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 43338936 |
| Molecular Formula | C16H13FO |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCC2)c1ccccc1F |
| InChI | InChI=1S/C16H13FO/c17-15-7-2-1-6-14(15)16(18)13-9-8-11-4-3-5-12(11)10-13/h1-2,6-10H,3-5H2 |
| InChIKey | BEWGSUNHOMPILF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |