C18H14FNO — CID 82782504
2,3-dihydro-1H-inden-5-yl-(4-fluoro-1H-indol-3-yl)methanone (PubChem CID 82782504) has the molecular formula C18H14FNO and a molecular weight of 279.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(4-fluoro-1H-indol-3-yl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(4-fluoro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 82782504 |
| Molecular Formula | C18H14FNO |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(4-fluoro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCC2)c1c[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C18H14FNO/c19-15-5-2-6-16-17(15)14(10-20-16)18(21)13-8-7-11-3-1-4-12(11)9-13/h2,5-10,20H,1,3-4H2 |
| InChIKey | PRVFNDQFSILHBZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |