C17H12BrNO2 — CID 115351607
(4-bromo-1H-indol-3-yl)-(1,3-dihydro-2-benzofuran-5-yl)methanone (PubChem CID 115351607) has the molecular formula C17H12BrNO2 and a molecular weight of 342.19 g/mol. Its IUPAC name is (4-bromo-1H-indol-3-yl)-(1,3-dihydro-2-benzofuran-5-yl)methanone.
| Compound Name | (4-bromo-1H-indol-3-yl)-(1,3-dihydro-2-benzofuran-5-yl)methanone |
|---|---|
| PubChem CID | 115351607 |
| Molecular Formula | C17H12BrNO2 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | (4-bromo-1H-indol-3-yl)-(1,3-dihydro-2-benzofuran-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)COC2)c1c[nH]c2cccc(Br)c12 |
| InChI | InChI=1S/C17H12BrNO2/c18-14-2-1-3-15-16(14)13(7-19-15)17(20)10-4-5-11-8-21-9-12(11)6-10/h1-7,19H,8-9H2 |
| InChIKey | SYUXYDCYKYMIQQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |