C19H16O3 — CID 8832153
4-[(E)-3-(2,3-dihydro-1H-inden-5-yl)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 8832153) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-[(E)-3-(2,3-dihydro-1H-inden-5-yl)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-(2,3-dihydro-1H-inden-5-yl)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 8832153 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[(E)-3-(2,3-dihydro-1H-inden-5-yl)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=C/C(=O)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C19H16O3/c20-18(17-10-9-14-2-1-3-16(14)12-17)11-6-13-4-7-15(8-5-13)19(21)22/h4-12H,1-3H2,(H,21,22)/b11-6+ |
| InChIKey | CUSFMPBUWLYPGY-IZZDOVSWSA-N |
| XLogP | 3.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|