C22H28O3Si2 — CID 6439249
4-[(E)-3-[3,5-bis(trimethylsilyl)phenyl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 6439249) has the molecular formula C22H28O3Si2 and a molecular weight of 396.64 g/mol. Its IUPAC name is 4-[(E)-3-[3,5-bis(trimethylsilyl)phenyl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[3,5-bis(trimethylsilyl)phenyl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 6439249 |
| Molecular Formula | C22H28O3Si2 |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-[(E)-3-[3,5-bis(trimethylsilyl)phenyl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | C[Si](C)(C)c1cc(C(=O)/C=C/c2ccc(C(=O)O)cc2)cc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C22H28O3Si2/c1-26(2,3)19-13-18(14-20(15-19)27(4,5)6)21(23)12-9-16-7-10-17(11-8-16)22(24)25/h7-15H,1-6H3,(H,24,25)/b12-9+ |
| InChIKey | HYBWXJWLXUZMJD-FMIVXFBMSA-N |
| XLogP | 4.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|