C19H20O3Si — CID 14605650
4-[(E)-3-oxo-3-(3-trimethylsilylphenyl)prop-1-enyl]benzoic acid (PubChem CID 14605650) has the molecular formula C19H20O3Si and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-[(E)-3-oxo-3-(3-trimethylsilylphenyl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-oxo-3-(3-trimethylsilylphenyl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 14605650 |
| Molecular Formula | C19H20O3Si |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-[(E)-3-oxo-3-(3-trimethylsilylphenyl)prop-1-enyl]benzoic acid |
| SMILES | C[Si](C)(C)c1cccc(C(=O)/C=C/c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C19H20O3Si/c1-23(2,3)17-6-4-5-16(13-17)18(20)12-9-14-7-10-15(11-8-14)19(21)22/h4-13H,1-3H3,(H,21,22)/b12-9+ |
| InChIKey | QQFALZYARHMPPJ-FMIVXFBMSA-N |
| XLogP | 3.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|