C18H17NO — CID 173488881
N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)-3-phenylprop-2-enylidene]hydroxylamine (PubChem CID 173488881) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)-3-phenylprop-2-enylidene]hydroxylamine.
| Compound Name | N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)-3-phenylprop-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 173488881 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)-3-phenylprop-2-enylidene]hydroxylamine |
| SMILES | ON=C(/C=C/c1ccccc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H17NO/c20-19-18(12-9-14-5-2-1-3-6-14)17-11-10-15-7-4-8-16(15)13-17/h1-3,5-6,9-13,20H,4,7-8H2/b12-9+,19-18? |
| InChIKey | CELJYYSEYSAPJA-MASWYUCRSA-N |
| XLogP | 4.07 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|