C19H18O2 — CID 27111136
(E)-3-(4-hydroxyphenyl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-en-1-one (PubChem CID 27111136) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is (E)-3-(4-hydroxyphenyl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-hydroxyphenyl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 27111136 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H18O2/c20-18-10-5-14(6-11-18)7-12-19(21)17-9-8-15-3-1-2-4-16(15)13-17/h5-13,20H,1-4H2/b12-7+ |
| InChIKey | VQYKMEHJIRJLRI-KPKJPENVSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|