C16H14O5S — CID 87534128
[4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]methanesulfonic acid (PubChem CID 87534128) has the molecular formula C16H14O5S and a molecular weight of 318.35 g/mol. Its IUPAC name is [4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]methanesulfonic acid.
| Compound Name | [4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 87534128 |
| Molecular Formula | C16H14O5S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | [4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenyl]methanesulfonic acid |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1ccc(CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H14O5S/c17-15-8-3-12(4-9-15)5-10-16(18)14-6-1-13(2-7-14)11-22(19,20)21/h1-10,17H,11H2,(H,19,20,21)/b10-5+ |
| InChIKey | CMQONHARMHWAMH-BJMVGYQFSA-N |
| XLogP | 2.68 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|