C29H24O4 — CID 174616800
1,3-diphenylprop-2-en-1-one;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 174616800) has the molecular formula C29H24O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1,3-diphenylprop-2-en-1-one;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 1,3-diphenylprop-2-en-1-one;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 174616800 |
| Molecular Formula | C29H24O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1,3-diphenylprop-2-en-1-one;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | O=C(C=Cc1ccccc1)c1ccccc1.Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C15H12O.C14H12O3/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-12H;1-9,15-17H/b;2-1+ |
| InChIKey | KSJMFEOCXOZHEQ-WLHGVMLRSA-N |
| XLogP | 6.56 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|