C14H12NO3+ — CID 126959177
3-(4-hydroxyphenyl)-1-(1-hydroxypyridin-1-ium-4-yl)prop-2-en-1-one (PubChem CID 126959177) has the molecular formula C14H12NO3+ and a molecular weight of 242.25 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-1-(1-hydroxypyridin-1-ium-4-yl)prop-2-en-1-one.
| Compound Name | 3-(4-hydroxyphenyl)-1-(1-hydroxypyridin-1-ium-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126959177 |
| Molecular Formula | C14H12NO3+ |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-(4-hydroxyphenyl)-1-(1-hydroxypyridin-1-ium-4-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(O)cc1)c1cc[n+](O)cc1 |
| InChI | InChI=1S/C14H11NO3/c16-13-4-1-11(2-5-13)3-6-14(17)12-7-9-15(18)10-8-12/h1-10H,(H-,16,17,18)/p+1 |
| InChIKey | JQMISQIKYIOODI-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 61.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|