C23H24O6 — CID 118274623
(E)-3-(4-ethoxyphenyl)-2-[4-(3-prop-2-enoyloxypropoxy)phenyl]prop-2-enoic acid (PubChem CID 118274623) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-2-[4-(3-prop-2-enoyloxypropoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-(4-ethoxyphenyl)-2-[4-(3-prop-2-enoyloxypropoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118274623 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-2-[4-(3-prop-2-enoyloxypropoxy)phenyl]prop-2-enoic acid |
| SMILES | C=CC(=O)OCCCOc1ccc(/C(=C\c2ccc(OCC)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C23H24O6/c1-3-22(24)29-15-5-14-28-20-12-8-18(9-13-20)21(23(25)26)16-17-6-10-19(11-7-17)27-4-2/h3,6-13,16H,1,4-5,14-15H2,2H3,(H,25,26)/b21-16+ |
| InChIKey | JGOXBRXPCUBGCM-LTGZKZEYSA-N |
| XLogP | 4.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|