C34H42O8 — CID 69491799
2-[2-methyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]-3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoic acid (PubChem CID 69491799) has the molecular formula C34H42O8 and a molecular weight of 578.70 g/mol. Its IUPAC name is 2-[2-methyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]-3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoic acid.
| Compound Name | 2-[2-methyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]-3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69491799 |
| Molecular Formula | C34H42O8 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 2-[2-methyl-4-(6-prop-2-enoyloxyhexoxy)phenyl]-3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]prop-2-enoic acid |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C=C(C(=O)O)c2ccc(OCCCCCCOC(=O)C=C)cc2C)cc1 |
| InChI | InChI=1S/C34H42O8/c1-4-32(35)41-22-12-8-6-10-20-39-28-16-14-27(15-17-28)25-31(34(37)38)30-19-18-29(24-26(30)3)40-21-11-7-9-13-23-42-33(36)5-2/h4-5,14-19,24-25H,1-2,6-13,20-23H2,3H3,(H,37,38) |
| InChIKey | MRVJAGOUROKSJY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|