C15H12ClFO — CID 64712749
(3-chloro-2-fluorophenyl)-(2,4-dimethylphenyl)methanone (PubChem CID 64712749) has the molecular formula C15H12ClFO and a molecular weight of 262.71 g/mol. Its IUPAC name is (3-chloro-2-fluorophenyl)-(2,4-dimethylphenyl)methanone.
| Compound Name | (3-chloro-2-fluorophenyl)-(2,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 64712749 |
| Molecular Formula | C15H12ClFO |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (3-chloro-2-fluorophenyl)-(2,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cccc(Cl)c2F)c(C)c1 |
| InChI | InChI=1S/C15H12ClFO/c1-9-6-7-11(10(2)8-9)15(18)12-4-3-5-13(16)14(12)17/h3-8H,1-2H3 |
| InChIKey | SFVOVOXADSFJOH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |