C15H12ClFO3 — CID 64714149
(3-chloro-2-fluorophenyl)-(2,5-dimethoxyphenyl)methanone (PubChem CID 64714149) has the molecular formula C15H12ClFO3 and a molecular weight of 294.71 g/mol. Its IUPAC name is (3-chloro-2-fluorophenyl)-(2,5-dimethoxyphenyl)methanone.
| Compound Name | (3-chloro-2-fluorophenyl)-(2,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 64714149 |
| Molecular Formula | C15H12ClFO3 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (3-chloro-2-fluorophenyl)-(2,5-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)c2cccc(Cl)c2F)c1 |
| InChI | InChI=1S/C15H12ClFO3/c1-19-9-6-7-13(20-2)11(8-9)15(18)10-4-3-5-12(16)14(10)17/h3-8H,1-2H3 |
| InChIKey | XPTLSPYQJBTQFO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |