C15H13IO3 — CID 15888023
(2,5-dimethoxyphenyl)-(2-iodophenyl)methanone (PubChem CID 15888023) has the molecular formula C15H13IO3 and a molecular weight of 368.17 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(2-iodophenyl)methanone.
| Compound Name | (2,5-dimethoxyphenyl)-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 15888023 |
| Molecular Formula | C15H13IO3 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(2-iodophenyl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C15H13IO3/c1-18-10-7-8-14(19-2)12(9-10)15(17)11-5-3-4-6-13(11)16/h3-9H,1-2H3 |
| InChIKey | DTOUHHKHNJVMFJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|