C16H15IO3 — CID 43626525
(4,5-dimethoxy-2-methylphenyl)-(2-iodophenyl)methanone (PubChem CID 43626525) has the molecular formula C16H15IO3 and a molecular weight of 382.20 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)-(2-iodophenyl)methanone.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 43626525 |
| Molecular Formula | C16H15IO3 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)-(2-iodophenyl)methanone |
| SMILES | COc1cc(C)c(C(=O)c2ccccc2I)cc1OC |
| InChI | InChI=1S/C16H15IO3/c1-10-8-14(19-2)15(20-3)9-12(10)16(18)11-6-4-5-7-13(11)17/h4-9H,1-3H3 |
| InChIKey | DCLVTLOMFNYYOX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|