C17H17IO — CID 43337332
(2-iodophenyl)-(2,3,5,6-tetramethylphenyl)methanone (PubChem CID 43337332) has the molecular formula C17H17IO and a molecular weight of 364.23 g/mol. Its IUPAC name is (2-iodophenyl)-(2,3,5,6-tetramethylphenyl)methanone.
| Compound Name | (2-iodophenyl)-(2,3,5,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 43337332 |
| Molecular Formula | C17H17IO |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (2-iodophenyl)-(2,3,5,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C)c(C(=O)c2ccccc2I)c1C |
| InChI | InChI=1S/C17H17IO/c1-10-9-11(2)13(4)16(12(10)3)17(19)14-7-5-6-8-15(14)18/h5-9H,1-4H3 |
| InChIKey | RENOWKMNKIEYTF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|