C18H19ClO — CID 43159787
(2-chlorophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone (PubChem CID 43159787) has the molecular formula C18H19ClO and a molecular weight of 286.80 g/mol. Its IUPAC name is (2-chlorophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone.
| Compound Name | (2-chlorophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone |
|---|---|
| PubChem CID | 43159787 |
| Molecular Formula | C18H19ClO |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2-chlorophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone |
| SMILES | Cc1c(C)c(C)c(C(=O)c2ccccc2Cl)c(C)c1C |
| InChI | InChI=1S/C18H19ClO/c1-10-11(2)13(4)17(14(5)12(10)3)18(20)15-8-6-7-9-16(15)19/h6-9H,1-5H3 |
| InChIKey | CDAOCVRFOKPBEI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |