C25H22Cl2O3P+ — CID 173245773
(2,6-dichlorobenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium (PubChem CID 173245773) has the molecular formula C25H22Cl2O3P+ and a molecular weight of 472.33 g/mol. Its IUPAC name is (2,6-dichlorobenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium.
| Compound Name | (2,6-dichlorobenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium |
|---|---|
| PubChem CID | 173245773 |
| Molecular Formula | C25H22Cl2O3P+ |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | (2,6-dichlorobenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium |
| SMILES | Cc1c(C)c(C)c(C(=O)c2ccccc2[P+](=O)C(=O)c2c(Cl)cccc2Cl)c(C)c1C |
| InChI | InChI=1S/C25H22Cl2O3P/c1-13-14(2)16(4)22(17(5)15(13)3)24(28)18-9-6-7-12-21(18)31(30)25(29)23-19(26)10-8-11-20(23)27/h6-12H,1-5H3/q+1 |
| InChIKey | MFDFSUXLHUTQFB-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|