C27H28O5P+ — CID 173244979
(2,6-dimethoxybenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium (PubChem CID 173244979) has the molecular formula C27H28O5P+ and a molecular weight of 463.49 g/mol. Its IUPAC name is (2,6-dimethoxybenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium.
| Compound Name | (2,6-dimethoxybenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium |
|---|---|
| PubChem CID | 173244979 |
| Molecular Formula | C27H28O5P+ |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2,6-dimethoxybenzoyl)-oxo-[2-(2,3,4,5,6-pentamethylbenzoyl)phenyl]phosphanium |
| SMILES | COc1cccc(OC)c1C(=O)[P+](=O)c1ccccc1C(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C27H28O5P/c1-15-16(2)18(4)24(19(5)17(15)3)26(28)20-11-8-9-14-23(20)33(30)27(29)25-21(31-6)12-10-13-22(25)32-7/h8-14H,1-7H3/q+1 |
| InChIKey | ZHXHDSXBGQRIGV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|