C25H24O5P+ — CID 173244334
[2-(2,6-dimethoxybenzoyl)phenyl]-oxo-(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 173244334) has the molecular formula C25H24O5P+ and a molecular weight of 435.44 g/mol. Its IUPAC name is [2-(2,6-dimethoxybenzoyl)phenyl]-oxo-(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | [2-(2,6-dimethoxybenzoyl)phenyl]-oxo-(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 173244334 |
| Molecular Formula | C25H24O5P+ |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | [2-(2,6-dimethoxybenzoyl)phenyl]-oxo-(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | COc1cccc(OC)c1C(=O)c1ccccc1[P+](=O)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H24O5P/c1-15-13-16(2)22(17(3)14-15)25(27)31(28)21-12-7-6-9-18(21)24(26)23-19(29-4)10-8-11-20(23)30-5/h6-14H,1-5H3/q+1 |
| InChIKey | RMFQQBDPQGKZJQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|