C21H26O2P+ — CID 173244333
oxo-pentyl-[2-(2,4,6-trimethylbenzoyl)phenyl]phosphanium (PubChem CID 173244333) has the molecular formula C21H26O2P+ and a molecular weight of 341.41 g/mol. Its IUPAC name is oxo-pentyl-[2-(2,4,6-trimethylbenzoyl)phenyl]phosphanium.
| Compound Name | oxo-pentyl-[2-(2,4,6-trimethylbenzoyl)phenyl]phosphanium |
|---|---|
| PubChem CID | 173244333 |
| Molecular Formula | C21H26O2P+ |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | oxo-pentyl-[2-(2,4,6-trimethylbenzoyl)phenyl]phosphanium |
| SMILES | CCCCC[P+](=O)c1ccccc1C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H26O2P/c1-5-6-9-12-24(23)19-11-8-7-10-18(19)21(22)20-16(3)13-15(2)14-17(20)4/h7-8,10-11,13-14H,5-6,9,12H2,1-4H3/q+1 |
| InChIKey | VEILYKHPCOOJHQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|