C16H18NaO2P — CID 146418297
sodium;phosphane;2-(2,4,6-trimethylbenzoyl)phenolate (PubChem CID 146418297) has the molecular formula C16H18NaO2P and a molecular weight of 296.28 g/mol. Its IUPAC name is sodium;phosphane;2-(2,4,6-trimethylbenzoyl)phenolate.
| Compound Name | sodium;phosphane;2-(2,4,6-trimethylbenzoyl)phenolate |
|---|---|
| PubChem CID | 146418297 |
| Molecular Formula | C16H18NaO2P |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | sodium;phosphane;2-(2,4,6-trimethylbenzoyl)phenolate |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2[O-])c(C)c1.P.[Na+] |
| InChI | InChI=1S/C16H16O2.Na.H3P/c1-10-8-11(2)15(12(3)9-10)16(18)13-6-4-5-7-14(13)17;;/h4-9,17H,1-3H3;;1H3/q;+1;/p-1 |
| InChIKey | HSLJIFJFLHPOED-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|